C13H23F3N2 — CID 65319020
2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1,1,1-trifluoropentan-3-amine (PubChem CID 65319020) has the molecular formula C13H23F3N2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1,1,1-trifluoropentan-3-amine.
| Compound Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1,1,1-trifluoropentan-3-amine |
|---|---|
| PubChem CID | 65319020 |
| Molecular Formula | C13H23F3N2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)-1,1,1-trifluoropentan-3-amine |
| SMILES | CCC(N)C(N1CCCC2CCCC21)C(F)(F)F |
| InChI | InChI=1S/C13H23F3N2/c1-2-10(17)12(13(14,15)16)18-8-4-6-9-5-3-7-11(9)18/h9-12H,2-8,17H2,1H3 |
| InChIKey | UGVHMNDTHQNLHZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |