C16H20F2N2O — CID 65324906
2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-[3,5-difluoro-4-(methylamino)phenyl]methanone (PubChem CID 65324906) has the molecular formula C16H20F2N2O and a molecular weight of 294.34 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-[3,5-difluoro-4-(methylamino)phenyl]methanone.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-[3,5-difluoro-4-(methylamino)phenyl]methanone |
|---|---|
| PubChem CID | 65324906 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-[3,5-difluoro-4-(methylamino)phenyl]methanone |
| SMILES | CNc1c(F)cc(C(=O)N2CCCC3CCCC32)cc1F |
| InChI | InChI=1S/C16H20F2N2O/c1-19-15-12(17)8-11(9-13(15)18)16(21)20-7-3-5-10-4-2-6-14(10)20/h8-10,14,19H,2-7H2,1H3 |
| InChIKey | FPSDGERMRMJXEV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |