About 1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol
1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol (PubChem CID 65328718) has the molecular formula C9H13NO2S
and a molecular weight of 199.27 g/mol. Its IUPAC name is 1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol.
Molecular Properties
| Compound Name | 1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol |
| PubChem CID | 65328718 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol |
| SMILES | CC(O)c1csc(C2CCCO2)n1 |
| InChI | InChI=1S/C9H13NO2S/c1-6(11)7-5-13-9(10-7)8-3-2-4-12-8/h5-6,8,11H,2-4H2,1H3 |
| InChIKey | SZPBKLSOEYDVFP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol?
The IUPAC name of 1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol (CID 65328718) is 1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol.
What is the SMILES notation for 1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol?
The canonical SMILES for 1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol is CC(O)c1csc(C2CCCO2)n1.
What is the InChIKey of 1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol?
The InChIKey is SZPBKLSOEYDVFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c1-6(11)7-5-13-9(10-7)8-3-2-4-12-8/h5-6,8,11H,2-4H2,1H3.
What are the key properties of 1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol?
1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol has a molecular weight of 199.27 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(oxolan-2-yl)-1,3-thiazol-4-yl]ethanol is sourced from PubChem (CID 65328718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).