C15H17N3O2S — CID 65344331
5-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]-2-methoxybenzenecarbothioamide (PubChem CID 65344331) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 5-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]-2-methoxybenzenecarbothioamide.
| Compound Name | 5-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]-2-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 65344331 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 5-[(2,4-dimethyl-6-oxopyrimidin-1-yl)methyl]-2-methoxybenzenecarbothioamide |
| SMILES | COc1ccc(Cn2c(C)nc(C)cc2=O)cc1C(N)=S |
| InChI | InChI=1S/C15H17N3O2S/c1-9-6-14(19)18(10(2)17-9)8-11-4-5-13(20-3)12(7-11)15(16)21/h4-7H,8H2,1-3H3,(H2,16,21) |
| InChIKey | JBFYPIWOLOHHHR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|