C12H8BrN5O2 — CID 65348041
4-(6-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-2-nitroaniline (PubChem CID 65348041) has the molecular formula C12H8BrN5O2 and a molecular weight of 334.13 g/mol. Its IUPAC name is 4-(6-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-2-nitroaniline.
| Compound Name | 4-(6-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-2-nitroaniline |
|---|---|
| PubChem CID | 65348041 |
| Molecular Formula | C12H8BrN5O2 |
| Molecular Weight | 334.13 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 4-(6-bromo-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-2-nitroaniline |
| SMILES | Nc1ccc(-c2nnc3ccc(Br)cn23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H8BrN5O2/c13-8-2-4-11-15-16-12(17(11)6-8)7-1-3-9(14)10(5-7)18(19)20/h1-6H,14H2 |
| InChIKey | WQWKKYACVULCFQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.13 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|