C13H15N5O2 — CID 62711941
4-(4-cyclopentyl-1,2,4-triazol-3-yl)-2-nitroaniline (PubChem CID 62711941) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 4-(4-cyclopentyl-1,2,4-triazol-3-yl)-2-nitroaniline.
| Compound Name | 4-(4-cyclopentyl-1,2,4-triazol-3-yl)-2-nitroaniline |
|---|---|
| PubChem CID | 62711941 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 4-(4-cyclopentyl-1,2,4-triazol-3-yl)-2-nitroaniline |
| SMILES | Nc1ccc(-c2nncn2C2CCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N5O2/c14-11-6-5-9(7-12(11)18(19)20)13-16-15-8-17(13)10-3-1-2-4-10/h5-8,10H,1-4,14H2 |
| InChIKey | QATHONFYZCOSEM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|