C15H20N4 — CID 104699010
4-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-methylaniline (PubChem CID 104699010) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-methylaniline.
| Compound Name | 4-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-methylaniline |
|---|---|
| PubChem CID | 104699010 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 4-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-methylaniline |
| SMILES | CNc1ccc(-c2nncn2C2CCCCC2)cc1 |
| InChI | InChI=1S/C15H20N4/c1-16-13-9-7-12(8-10-13)15-18-17-11-19(15)14-5-3-2-4-6-14/h7-11,14,16H,2-6H2,1H3 |
| InChIKey | NXBIAHYGLBFVJT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |