About 5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride
5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride (PubChem CID 65366942) has the molecular formula C13H19ClN2O3S
and a molecular weight of 318.83 g/mol. Its IUPAC name is 5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride.
Molecular Properties
| Compound Name | 5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride |
| PubChem CID | 65366942 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride |
| SMILES | CC1(C)CCCN(C(=O)c2cc(S(=O)(=O)Cl)c[nH]2)CC1 |
| InChI | InChI=1S/C13H19ClN2O3S/c1-13(2)4-3-6-16(7-5-13)12(17)11-8-10(9-15-11)20(14,18)19/h8-9,15H,3-7H2,1-2H3 |
| InChIKey | OYHTZJZTRPXGKZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride?
The IUPAC name of 5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride (CID 65366942) is 5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride.
What is the SMILES notation for 5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride?
The canonical SMILES for 5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride is CC1(C)CCCN(C(=O)c2cc(S(=O)(=O)Cl)c[nH]2)CC1.
What is the InChIKey of 5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride?
The InChIKey is OYHTZJZTRPXGKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClN2O3S/c1-13(2)4-3-6-16(7-5-13)12(17)11-8-10(9-15-11)20(14,18)19/h8-9,15H,3-7H2,1-2H3.
What are the key properties of 5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride?
5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride has a molecular weight of 318.83 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-dimethylazepane-1-carbonyl)-1H-pyrrole-3-sulfonyl chloride is sourced from PubChem (CID 65366942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).