C13H18N2O — CID 65381167
1-(2-ethoxyphenyl)-N-prop-2-ynylethane-1,2-diamine (PubChem CID 65381167) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-N-prop-2-ynylethane-1,2-diamine.
| Compound Name | 1-(2-ethoxyphenyl)-N-prop-2-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 65381167 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-(2-ethoxyphenyl)-N-prop-2-ynylethane-1,2-diamine |
| SMILES | C#CCNC(CN)c1ccccc1OCC |
| InChI | InChI=1S/C13H18N2O/c1-3-9-15-12(10-14)11-7-5-6-8-13(11)16-4-2/h1,5-8,12,15H,4,9-10,14H2,2H3 |
| InChIKey | ZSWRZCPZMHKNQI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|