C12H14ClNO3S2 — CID 65396129
4-[cyclopropyl(cyclopropylmethyl)carbamoyl]thiophene-2-sulfonyl chloride (PubChem CID 65396129) has the molecular formula C12H14ClNO3S2 and a molecular weight of 319.84 g/mol. Its IUPAC name is 4-[cyclopropyl(cyclopropylmethyl)carbamoyl]thiophene-2-sulfonyl chloride.
| Compound Name | 4-[cyclopropyl(cyclopropylmethyl)carbamoyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 65396129 |
| Molecular Formula | C12H14ClNO3S2 |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 4-[cyclopropyl(cyclopropylmethyl)carbamoyl]thiophene-2-sulfonyl chloride |
| SMILES | O=C(c1csc(S(=O)(=O)Cl)c1)N(CC1CC1)C1CC1 |
| InChI | InChI=1S/C12H14ClNO3S2/c13-19(16,17)11-5-9(7-18-11)12(15)14(10-3-4-10)6-8-1-2-8/h5,7-8,10H,1-4,6H2 |
| InChIKey | UVAPPWIVICEUFT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |