C17H27NO5 — CID 6542913
ethyl (3R,4R,5S)-5-(cyclohexylcarbamoyl)-3-ethyl-4-methyl-2-oxooxolane-3-carboxylate (PubChem CID 6542913) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is ethyl (3R,4R,5S)-5-(cyclohexylcarbamoyl)-3-ethyl-4-methyl-2-oxooxolane-3-carboxylate.
| Compound Name | ethyl (3R,4R,5S)-5-(cyclohexylcarbamoyl)-3-ethyl-4-methyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 6542913 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | ethyl (3R,4R,5S)-5-(cyclohexylcarbamoyl)-3-ethyl-4-methyl-2-oxooxolane-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(CC)C(=O)O[C@H](C(=O)NC2CCCCC2)[C@@H]1C |
| InChI | InChI=1S/C17H27NO5/c1-4-17(15(20)22-5-2)11(3)13(23-16(17)21)14(19)18-12-9-7-6-8-10-12/h11-13H,4-10H2,1-3H3,(H,18,19)/t11-,13-,17+/m0/s1 |
| InChIKey | YGKNEFFMXHQDKE-PLQHRBFRSA-N |
| XLogP | 1.96 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|