C20H33NO5 — CID 7315630
ethyl (3S,4R,5R)-5-(cyclohexylcarbamoyl)-4-methyl-2-oxo-3-pentyloxolane-3-carboxylate (PubChem CID 7315630) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is ethyl (3S,4R,5R)-5-(cyclohexylcarbamoyl)-4-methyl-2-oxo-3-pentyloxolane-3-carboxylate.
| Compound Name | ethyl (3S,4R,5R)-5-(cyclohexylcarbamoyl)-4-methyl-2-oxo-3-pentyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 7315630 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | ethyl (3S,4R,5R)-5-(cyclohexylcarbamoyl)-4-methyl-2-oxo-3-pentyloxolane-3-carboxylate |
| SMILES | CCCCC[C@]1(C(=O)OCC)C(=O)O[C@@H](C(=O)NC2CCCCC2)[C@@H]1C |
| InChI | InChI=1S/C20H33NO5/c1-4-6-10-13-20(18(23)25-5-2)14(3)16(26-19(20)24)17(22)21-15-11-8-7-9-12-15/h14-16H,4-13H2,1-3H3,(H,21,22)/t14-,16+,20-/m0/s1 |
| InChIKey | UXRPUZRQDCRKMP-NBQZKYEYSA-N |
| XLogP | 3.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|