C12H12BrFN4O3 — CID 65435926
1-(4-bromo-3-fluoroanilino)-3-(4-nitropyrazol-1-yl)propan-2-ol (PubChem CID 65435926) has the molecular formula C12H12BrFN4O3 and a molecular weight of 359.16 g/mol. Its IUPAC name is 1-(4-bromo-3-fluoroanilino)-3-(4-nitropyrazol-1-yl)propan-2-ol.
| Compound Name | 1-(4-bromo-3-fluoroanilino)-3-(4-nitropyrazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 65435926 |
| Molecular Formula | C12H12BrFN4O3 |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 1-(4-bromo-3-fluoroanilino)-3-(4-nitropyrazol-1-yl)propan-2-ol |
| SMILES | O=[N+]([O-])c1cnn(CC(O)CNc2ccc(Br)c(F)c2)c1 |
| InChI | InChI=1S/C12H12BrFN4O3/c13-11-2-1-8(3-12(11)14)15-5-10(19)7-17-6-9(4-16-17)18(20)21/h1-4,6,10,15,19H,5,7H2 |
| InChIKey | UEWDIHSOPASSBW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|