C14H20Cl2N2O — CID 65461570
1-[2-(2,4-dichlorophenoxy)ethyl]-2,2-dimethylpiperazine (PubChem CID 65461570) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenoxy)ethyl]-2,2-dimethylpiperazine.
| Compound Name | 1-[2-(2,4-dichlorophenoxy)ethyl]-2,2-dimethylpiperazine |
|---|---|
| PubChem CID | 65461570 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-[2-(2,4-dichlorophenoxy)ethyl]-2,2-dimethylpiperazine |
| SMILES | CC1(C)CNCCN1CCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H20Cl2N2O/c1-14(2)10-17-5-6-18(14)7-8-19-13-4-3-11(15)9-12(13)16/h3-4,9,17H,5-8,10H2,1-2H3 |
| InChIKey | CNAVJJVQLNEXNW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |