About 2-methylpropan-1-amine
2-methylpropan-1-amine (PubChem CID 6558) has the molecular formula C4H11N
and a molecular weight of 73.14 g/mol. Its IUPAC name is 2-methylpropan-1-amine.
Molecular Properties
| Compound Name | 2-methylpropan-1-amine |
| PubChem CID | 6558 |
| Molecular Formula | C4H11N |
| Molecular Weight | 73.14 g/mol |
| Exact Mass | 73.09 |
| IUPAC Name | 2-methylpropan-1-amine |
| SMILES | CC(C)CN |
| InChI | InChI=1S/C4H11N/c1-4(2)3-5/h4H,3,5H2,1-2H3 |
| InChIKey | KDSNLYIMUZNERS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 73.14 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-1-amine?
The IUPAC name of 2-methylpropan-1-amine (CID 6558) is 2-methylpropan-1-amine.
What is the SMILES notation for 2-methylpropan-1-amine?
The canonical SMILES for 2-methylpropan-1-amine is CC(C)CN.
What is the InChIKey of 2-methylpropan-1-amine?
The InChIKey is KDSNLYIMUZNERS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N/c1-4(2)3-5/h4H,3,5H2,1-2H3.
What are the key properties of 2-methylpropan-1-amine?
2-methylpropan-1-amine has a molecular weight of 73.14 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-1-amine is sourced from PubChem (CID 6558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).