C13H14N2O4S — CID 655814
3-[(1,3-thiazol-2-ylamino)methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione (PubChem CID 655814) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-[(1,3-thiazol-2-ylamino)methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[(1,3-thiazol-2-ylamino)methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 655814 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-[(1,3-thiazol-2-ylamino)methylidene]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
| SMILES | O=C1OC2(CCCCC2)OC(=O)C1=CNc1nccs1 |
| InChI | InChI=1S/C13H14N2O4S/c16-10-9(8-15-12-14-6-7-20-12)11(17)19-13(18-10)4-2-1-3-5-13/h6-8H,1-5H2,(H,14,15) |
| InChIKey | OZYPBVQLGOTTQO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|