C15H20N4O2 — CID 659941
(3-amino-1,2,4-triazol-1-yl)-(4-hexoxyphenyl)methanone (PubChem CID 659941) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is (3-amino-1,2,4-triazol-1-yl)-(4-hexoxyphenyl)methanone.
| Compound Name | (3-amino-1,2,4-triazol-1-yl)-(4-hexoxyphenyl)methanone |
|---|---|
| PubChem CID | 659941 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (3-amino-1,2,4-triazol-1-yl)-(4-hexoxyphenyl)methanone |
| SMILES | CCCCCCOc1ccc(C(=O)n2cnc(N)n2)cc1 |
| InChI | InChI=1S/C15H20N4O2/c1-2-3-4-5-10-21-13-8-6-12(7-9-13)14(20)19-11-17-15(16)18-19/h6-9,11H,2-5,10H2,1H3,(H2,16,18) |
| InChIKey | XVSYHKZTGULKDH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|