C16H32O3S — CID 66023920
[4-tert-butyl-1-(3-ethylsulfonylpropyl)cyclohexyl]methanol (PubChem CID 66023920) has the molecular formula C16H32O3S and a molecular weight of 304.50 g/mol. Its IUPAC name is [4-tert-butyl-1-(3-ethylsulfonylpropyl)cyclohexyl]methanol.
| Compound Name | [4-tert-butyl-1-(3-ethylsulfonylpropyl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 66023920 |
| Molecular Formula | C16H32O3S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | [4-tert-butyl-1-(3-ethylsulfonylpropyl)cyclohexyl]methanol |
| SMILES | CCS(=O)(=O)CCCC1(CO)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H32O3S/c1-5-20(18,19)12-6-9-16(13-17)10-7-14(8-11-16)15(2,3)4/h14,17H,5-13H2,1-4H3 |
| InChIKey | MXPLTQQUWBYENJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |