C18H31ClN2 — CID 66033963
3-[[4-butyl-1-(chloromethyl)cyclohexyl]methyl]-1-propan-2-ylpyrazole (PubChem CID 66033963) has the molecular formula C18H31ClN2 and a molecular weight of 310.91 g/mol. Its IUPAC name is 3-[[4-butyl-1-(chloromethyl)cyclohexyl]methyl]-1-propan-2-ylpyrazole.
| Compound Name | 3-[[4-butyl-1-(chloromethyl)cyclohexyl]methyl]-1-propan-2-ylpyrazole |
|---|---|
| PubChem CID | 66033963 |
| Molecular Formula | C18H31ClN2 |
| Molecular Weight | 310.91 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 3-[[4-butyl-1-(chloromethyl)cyclohexyl]methyl]-1-propan-2-ylpyrazole |
| SMILES | CCCCC1CCC(CCl)(Cc2ccn(C(C)C)n2)CC1 |
| InChI | InChI=1S/C18H31ClN2/c1-4-5-6-16-7-10-18(14-19,11-8-16)13-17-9-12-21(20-17)15(2)3/h9,12,15-16H,4-8,10-11,13-14H2,1-3H3 |
| InChIKey | IFYDUKBEEGUQRQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.91 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|