C18H23Br — CID 66050152
5-[[2-(bromomethyl)-2-bicyclo[2.2.1]heptanyl]methyl]-2,3-dihydro-1H-indene (PubChem CID 66050152) has the molecular formula C18H23Br and a molecular weight of 319.29 g/mol. Its IUPAC name is 5-[[2-(bromomethyl)-2-bicyclo[2.2.1]heptanyl]methyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[[2-(bromomethyl)-2-bicyclo[2.2.1]heptanyl]methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 66050152 |
| Molecular Formula | C18H23Br |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 5-[[2-(bromomethyl)-2-bicyclo[2.2.1]heptanyl]methyl]-2,3-dihydro-1H-indene |
| SMILES | BrCC1(Cc2ccc3c(c2)CCC3)CC2CCC1C2 |
| InChI | InChI=1S/C18H23Br/c19-12-18(11-14-5-7-17(18)9-14)10-13-4-6-15-2-1-3-16(15)8-13/h4,6,8,14,17H,1-3,5,7,9-12H2 |
| InChIKey | VOJUNTHWEHNCGE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|