C11H15BrO2S2 — CID 66050392
3-(1-bromo-3-thiophen-3-ylpropan-2-yl)thiolane 1,1-dioxide (PubChem CID 66050392) has the molecular formula C11H15BrO2S2 and a molecular weight of 323.28 g/mol. Its IUPAC name is 3-(1-bromo-3-thiophen-3-ylpropan-2-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(1-bromo-3-thiophen-3-ylpropan-2-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 66050392 |
| Molecular Formula | C11H15BrO2S2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | 3-(1-bromo-3-thiophen-3-ylpropan-2-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CBr)Cc2ccsc2)C1 |
| InChI | InChI=1S/C11H15BrO2S2/c12-6-11(5-9-1-3-15-7-9)10-2-4-16(13,14)8-10/h1,3,7,10-11H,2,4-6,8H2 |
| InChIKey | OLZKEQWDFMJRQN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|