C12H11N3O6 — CID 66062414
4-[(3,5-dioxopiperazine-1-carbonyl)amino]-3-hydroxybenzoic acid (PubChem CID 66062414) has the molecular formula C12H11N3O6 and a molecular weight of 293.23 g/mol. Its IUPAC name is 4-[(3,5-dioxopiperazine-1-carbonyl)amino]-3-hydroxybenzoic acid.
| Compound Name | 4-[(3,5-dioxopiperazine-1-carbonyl)amino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 66062414 |
| Molecular Formula | C12H11N3O6 |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 4-[(3,5-dioxopiperazine-1-carbonyl)amino]-3-hydroxybenzoic acid |
| SMILES | O=C1CN(C(=O)Nc2ccc(C(=O)O)cc2O)CC(=O)N1 |
| InChI | InChI=1S/C12H11N3O6/c16-8-3-6(11(19)20)1-2-7(8)13-12(21)15-4-9(17)14-10(18)5-15/h1-3,16H,4-5H2,(H,13,21)(H,19,20)(H,14,17,18) |
| InChIKey | RIQHFBQKAKGMOF-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|