C12H16N4O4 — CID 66067185
5-(2-ethyl-3,5-dioxopiperazin-1-yl)-1,3-dimethylpyrazole-4-carboxylic acid (PubChem CID 66067185) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 5-(2-ethyl-3,5-dioxopiperazin-1-yl)-1,3-dimethylpyrazole-4-carboxylic acid.
| Compound Name | 5-(2-ethyl-3,5-dioxopiperazin-1-yl)-1,3-dimethylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66067185 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 5-(2-ethyl-3,5-dioxopiperazin-1-yl)-1,3-dimethylpyrazole-4-carboxylic acid |
| SMILES | CCC1C(=O)NC(=O)CN1c1c(C(=O)O)c(C)nn1C |
| InChI | InChI=1S/C12H16N4O4/c1-4-7-10(18)13-8(17)5-16(7)11-9(12(19)20)6(2)14-15(11)3/h7H,4-5H2,1-3H3,(H,19,20)(H,13,17,18) |
| InChIKey | MCBVBZIOKISNEC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|