C14H14N4O3 — CID 66067199
N-(4-cyanophenyl)-2-ethyl-3,5-dioxopiperazine-1-carboxamide (PubChem CID 66067199) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-ethyl-3,5-dioxopiperazine-1-carboxamide.
| Compound Name | N-(4-cyanophenyl)-2-ethyl-3,5-dioxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 66067199 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-(4-cyanophenyl)-2-ethyl-3,5-dioxopiperazine-1-carboxamide |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H14N4O3/c1-2-11-13(20)17-12(19)8-18(11)14(21)16-10-5-3-9(7-15)4-6-10/h3-6,11H,2,8H2,1H3,(H,16,21)(H,17,19,20) |
| InChIKey | FVXRHRMZMNIXNW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|