C13H14FNO2S2 — CID 66070178
4-(dimethoxymethyl)-2-[(3-fluorophenyl)sulfanylmethyl]-1,3-thiazole (PubChem CID 66070178) has the molecular formula C13H14FNO2S2 and a molecular weight of 299.39 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2-[(3-fluorophenyl)sulfanylmethyl]-1,3-thiazole.
| Compound Name | 4-(dimethoxymethyl)-2-[(3-fluorophenyl)sulfanylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 66070178 |
| Molecular Formula | C13H14FNO2S2 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 4-(dimethoxymethyl)-2-[(3-fluorophenyl)sulfanylmethyl]-1,3-thiazole |
| SMILES | COC(OC)c1csc(CSc2cccc(F)c2)n1 |
| InChI | InChI=1S/C13H14FNO2S2/c1-16-13(17-2)11-7-19-12(15-11)8-18-10-5-3-4-9(14)6-10/h3-7,13H,8H2,1-2H3 |
| InChIKey | SPRLVCBZOGQNLE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|