C13H13BrFNOS — CID 66072018
1-(3-bromofuran-2-yl)-2-(4-fluorophenyl)sulfanyl-N-methylethanamine (PubChem CID 66072018) has the molecular formula C13H13BrFNOS and a molecular weight of 330.22 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-2-(4-fluorophenyl)sulfanyl-N-methylethanamine.
| Compound Name | 1-(3-bromofuran-2-yl)-2-(4-fluorophenyl)sulfanyl-N-methylethanamine |
|---|---|
| PubChem CID | 66072018 |
| Molecular Formula | C13H13BrFNOS |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-2-(4-fluorophenyl)sulfanyl-N-methylethanamine |
| SMILES | CNC(CSc1ccc(F)cc1)c1occc1Br |
| InChI | InChI=1S/C13H13BrFNOS/c1-16-12(13-11(14)6-7-17-13)8-18-10-4-2-9(15)3-5-10/h2-7,12,16H,8H2,1H3 |
| InChIKey | HKTLMRUJGWZQNY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |