C12H14N4O5 — CID 66074568
4-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-3,3-dimethylpiperazine-2,6-dione (PubChem CID 66074568) has the molecular formula C12H14N4O5 and a molecular weight of 294.27 g/mol. Its IUPAC name is 4-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66074568 |
| Molecular Formula | C12H14N4O5 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C12H14N4O5/c1-12(2)11(21)13-8(18)5-15(12)10(20)6-16-9(19)4-3-7(17)14-16/h3-4H,5-6H2,1-2H3,(H,14,17)(H,13,18,21) |
| InChIKey | UOXBYIDEZYRCBW-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|