C10H14N2O3 — CID 77112110
4-but-2-enoyl-3,3-dimethylpiperazine-2,6-dione (PubChem CID 77112110) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 4-but-2-enoyl-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-but-2-enoyl-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 77112110 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 4-but-2-enoyl-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC=CC(=O)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C10H14N2O3/c1-4-5-8(14)12-6-7(13)11-9(15)10(12,2)3/h4-5H,6H2,1-3H3,(H,11,13,15) |
| InChIKey | WOKGRQZCYPVMDH-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|