C10H10N4O5 — CID 66085880
2-[2-(3,5-dioxopiperazin-1-yl)-2-oxoethyl]-1H-pyridazine-3,6-dione (PubChem CID 66085880) has the molecular formula C10H10N4O5 and a molecular weight of 266.21 g/mol. Its IUPAC name is 2-[2-(3,5-dioxopiperazin-1-yl)-2-oxoethyl]-1H-pyridazine-3,6-dione.
| Compound Name | 2-[2-(3,5-dioxopiperazin-1-yl)-2-oxoethyl]-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 66085880 |
| Molecular Formula | C10H10N4O5 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-[2-(3,5-dioxopiperazin-1-yl)-2-oxoethyl]-1H-pyridazine-3,6-dione |
| SMILES | O=C1CN(C(=O)Cn2[nH]c(=O)ccc2=O)CC(=O)N1 |
| InChI | InChI=1S/C10H10N4O5/c15-6-1-2-9(18)14(12-6)5-10(19)13-3-7(16)11-8(17)4-13/h1-2H,3-5H2,(H,12,15)(H,11,16,17) |
| InChIKey | YQVKJZMGVROJSB-UHFFFAOYSA-N |
| XLogP | -2.98 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|