C12H10N4O6 — CID 175805177
2-(2,5-dioxopyrrol-1-yl)-N'-[2-(2,5-dioxopyrrol-1-yl)acetyl]acetohydrazide (PubChem CID 175805177) has the molecular formula C12H10N4O6 and a molecular weight of 306.23 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-N'-[2-(2,5-dioxopyrrol-1-yl)acetyl]acetohydrazide.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)-N'-[2-(2,5-dioxopyrrol-1-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 175805177 |
| Molecular Formula | C12H10N4O6 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)-N'-[2-(2,5-dioxopyrrol-1-yl)acetyl]acetohydrazide |
| SMILES | O=C(CN1C(=O)C=CC1=O)NNC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H10N4O6/c17-7(5-15-9(19)1-2-10(15)20)13-14-8(18)6-16-11(21)3-4-12(16)22/h1-4H,5-6H2,(H,13,17)(H,14,18) |
| InChIKey | TWLGGNAMENOBAM-UHFFFAOYSA-N |
| XLogP | -3.02 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|