C12H13N5O2 — CID 66076013
5,6-dimethyl-3-(2-methyl-3,5-dioxopiperazin-1-yl)pyridazine-4-carbonitrile (PubChem CID 66076013) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 5,6-dimethyl-3-(2-methyl-3,5-dioxopiperazin-1-yl)pyridazine-4-carbonitrile.
| Compound Name | 5,6-dimethyl-3-(2-methyl-3,5-dioxopiperazin-1-yl)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 66076013 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 5,6-dimethyl-3-(2-methyl-3,5-dioxopiperazin-1-yl)pyridazine-4-carbonitrile |
| SMILES | Cc1nnc(N2CC(=O)NC(=O)C2C)c(C#N)c1C |
| InChI | InChI=1S/C12H13N5O2/c1-6-7(2)15-16-11(9(6)4-13)17-5-10(18)14-12(19)8(17)3/h8H,5H2,1-3H3,(H,14,18,19) |
| InChIKey | LZNWYCUNGISSET-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|