C15H25NO4 — CID 66091719
4-amino-3-(3,4,5-trimethoxyphenyl)hexan-1-ol (PubChem CID 66091719) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-amino-3-(3,4,5-trimethoxyphenyl)hexan-1-ol.
| Compound Name | 4-amino-3-(3,4,5-trimethoxyphenyl)hexan-1-ol |
|---|---|
| PubChem CID | 66091719 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 4-amino-3-(3,4,5-trimethoxyphenyl)hexan-1-ol |
| SMILES | CCC(N)C(CCO)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H25NO4/c1-5-12(16)11(6-7-17)10-8-13(18-2)15(20-4)14(9-10)19-3/h8-9,11-12,17H,5-7,16H2,1-4H3 |
| InChIKey | NIAFQKMZRWKFDV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |