C12H17BrFN3O2 — CID 66111283
2-N-(4-bromo-5-fluoro-2-nitrophenyl)-2-ethylbutane-1,2-diamine (PubChem CID 66111283) has the molecular formula C12H17BrFN3O2 and a molecular weight of 334.19 g/mol. Its IUPAC name is 2-N-(4-bromo-5-fluoro-2-nitrophenyl)-2-ethylbutane-1,2-diamine.
| Compound Name | 2-N-(4-bromo-5-fluoro-2-nitrophenyl)-2-ethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 66111283 |
| Molecular Formula | C12H17BrFN3O2 |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-N-(4-bromo-5-fluoro-2-nitrophenyl)-2-ethylbutane-1,2-diamine |
| SMILES | CCC(CC)(CN)Nc1cc(F)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17BrFN3O2/c1-3-12(4-2,7-15)16-10-6-9(14)8(13)5-11(10)17(18)19/h5-6,16H,3-4,7,15H2,1-2H3 |
| InChIKey | NWQBUGIQVBKIEY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|