C14H18O3S — CID 66113048
3-(2,3-dihydro-1H-inden-5-ylmethylsulfinyl)butanoic acid (PubChem CID 66113048) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-ylmethylsulfinyl)butanoic acid.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-ylmethylsulfinyl)butanoic acid |
|---|---|
| PubChem CID | 66113048 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-ylmethylsulfinyl)butanoic acid |
| SMILES | CC(CC(=O)O)S(=O)Cc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H18O3S/c1-10(7-14(15)16)18(17)9-11-5-6-12-3-2-4-13(12)8-11/h5-6,8,10H,2-4,7,9H2,1H3,(H,15,16) |
| InChIKey | MMSRMHBYHVJLDJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |