C9H16O5S2 — CID 66114201
methyl 3-(1,1-dioxothiolan-3-yl)sulfinylbutanoate (PubChem CID 66114201) has the molecular formula C9H16O5S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is methyl 3-(1,1-dioxothiolan-3-yl)sulfinylbutanoate.
| Compound Name | methyl 3-(1,1-dioxothiolan-3-yl)sulfinylbutanoate |
|---|---|
| PubChem CID | 66114201 |
| Molecular Formula | C9H16O5S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | methyl 3-(1,1-dioxothiolan-3-yl)sulfinylbutanoate |
| SMILES | COC(=O)CC(C)S(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16O5S2/c1-7(5-9(10)14-2)15(11)8-3-4-16(12,13)6-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | UAIHXSZTVKXCFW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |