C7H13N5OS — CID 66115863
3-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]propan-1-ol (PubChem CID 66115863) has the molecular formula C7H13N5OS and a molecular weight of 215.28 g/mol. Its IUPAC name is 3-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]propan-1-ol.
| Compound Name | 3-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 66115863 |
| Molecular Formula | C7H13N5OS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 3-[(4,6-diamino-1,3,5-triazin-2-yl)methylsulfanyl]propan-1-ol |
| SMILES | Nc1nc(N)nc(CSCCCO)n1 |
| InChI | InChI=1S/C7H13N5OS/c8-6-10-5(11-7(9)12-6)4-14-3-1-2-13/h13H,1-4H2,(H4,8,9,10,11,12) |
| InChIKey | VLNGQARIAJMTBR-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|