C14H21N5O — CID 66121030
5-(1,3-diethylpyrazol-5-yl)-3-piperidin-3-yl-1,2,4-oxadiazole (PubChem CID 66121030) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 5-(1,3-diethylpyrazol-5-yl)-3-piperidin-3-yl-1,2,4-oxadiazole.
| Compound Name | 5-(1,3-diethylpyrazol-5-yl)-3-piperidin-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 66121030 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 5-(1,3-diethylpyrazol-5-yl)-3-piperidin-3-yl-1,2,4-oxadiazole |
| SMILES | CCc1cc(-c2nc(C3CCCNC3)no2)n(CC)n1 |
| InChI | InChI=1S/C14H21N5O/c1-3-11-8-12(19(4-2)17-11)14-16-13(18-20-14)10-6-5-7-15-9-10/h8,10,15H,3-7,9H2,1-2H3 |
| InChIKey | SWLUEXURVAFXQS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |