C11H20O3S — CID 66127429
3-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)propan-1-ol (PubChem CID 66127429) has the molecular formula C11H20O3S and a molecular weight of 232.34 g/mol. Its IUPAC name is 3-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)propan-1-ol.
| Compound Name | 3-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)propan-1-ol |
|---|---|
| PubChem CID | 66127429 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)propan-1-ol |
| SMILES | OCCCSCC1COC2(CCCC2)O1 |
| InChI | InChI=1S/C11H20O3S/c12-6-3-7-15-9-10-8-13-11(14-10)4-1-2-5-11/h10,12H,1-9H2 |
| InChIKey | PFUORLGQBSSXLO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|