C9H11ClN2O6S2 — CID 66127438
4-(3-chloropropylsulfonyl)-3-nitrobenzenesulfonamide (PubChem CID 66127438) has the molecular formula C9H11ClN2O6S2 and a molecular weight of 342.78 g/mol. Its IUPAC name is 4-(3-chloropropylsulfonyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-(3-chloropropylsulfonyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 66127438 |
| Molecular Formula | C9H11ClN2O6S2 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 4-(3-chloropropylsulfonyl)-3-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)CCCCl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H11ClN2O6S2/c10-4-1-5-19(15,16)9-3-2-7(20(11,17)18)6-8(9)12(13)14/h2-3,6H,1,4-5H2,(H2,11,17,18) |
| InChIKey | IYZSLBKOJHLPBY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|