C11H14O2S2 — CID 66128100
3-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methylsulfanyl]propan-1-ol (PubChem CID 66128100) has the molecular formula C11H14O2S2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 3-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methylsulfanyl]propan-1-ol.
| Compound Name | 3-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 66128100 |
| Molecular Formula | C11H14O2S2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 3-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methylsulfanyl]propan-1-ol |
| SMILES | OCC#Cc1ccc(CSCCCO)s1 |
| InChI | InChI=1S/C11H14O2S2/c12-6-1-3-10-4-5-11(15-10)9-14-8-2-7-13/h4-5,12-13H,2,6-9H2 |
| InChIKey | PUBWYZHNKVERRT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|