C10H10ClF2NO4S — CID 66136563
3-(4-chlorobutan-2-ylsulfonyl)-1,2-difluoro-4-nitrobenzene (PubChem CID 66136563) has the molecular formula C10H10ClF2NO4S and a molecular weight of 313.71 g/mol. Its IUPAC name is 3-(4-chlorobutan-2-ylsulfonyl)-1,2-difluoro-4-nitrobenzene.
| Compound Name | 3-(4-chlorobutan-2-ylsulfonyl)-1,2-difluoro-4-nitrobenzene |
|---|---|
| PubChem CID | 66136563 |
| Molecular Formula | C10H10ClF2NO4S |
| Molecular Weight | 313.71 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | 3-(4-chlorobutan-2-ylsulfonyl)-1,2-difluoro-4-nitrobenzene |
| SMILES | CC(CCCl)S(=O)(=O)c1c([N+](=O)[O-])ccc(F)c1F |
| InChI | InChI=1S/C10H10ClF2NO4S/c1-6(4-5-11)19(17,18)10-8(14(15)16)3-2-7(12)9(10)13/h2-3,6H,4-5H2,1H3 |
| InChIKey | QTPURCZXZINCOB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.71 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|