C25H33N3O6 — CID 6613978
[(2S)-1-[2-[[(2S)-1-hydroxypropan-2-yl]carbamoyl]pent-4-enoylamino]propan-2-yl] (2R)-2-(1,3-benzoxazol-2-ylmethyl)pent-4-enoate (PubChem CID 6613978) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is [(2S)-1-[2-[[(2S)-1-hydroxypropan-2-yl]carbamoyl]pent-4-enoylamino]propan-2-yl] (2R)-2-(1,3-benzoxazol-2-ylmethyl)pent-4-enoate.
| Compound Name | [(2S)-1-[2-[[(2S)-1-hydroxypropan-2-yl]carbamoyl]pent-4-enoylamino]propan-2-yl] (2R)-2-(1,3-benzoxazol-2-ylmethyl)pent-4-enoate |
|---|---|
| PubChem CID | 6613978 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | [(2S)-1-[2-[[(2S)-1-hydroxypropan-2-yl]carbamoyl]pent-4-enoylamino]propan-2-yl] (2R)-2-(1,3-benzoxazol-2-ylmethyl)pent-4-enoate |
| SMILES | C=CCC(C(=O)NC[C@H](C)OC(=O)[C@H](CC=C)Cc1nc2ccccc2o1)C(=O)N[C@@H](C)CO |
| InChI | InChI=1S/C25H33N3O6/c1-5-9-18(13-22-28-20-11-7-8-12-21(20)34-22)25(32)33-17(4)14-26-23(30)19(10-6-2)24(31)27-16(3)15-29/h5-8,11-12,16-19,29H,1-2,9-10,13-15H2,3-4H3,(H,26,30)(H,27,31)/t16-,17-,18+,19?/m0/s1 |
| InChIKey | HDUOYBHIWUNWHR-HTUJPFKRSA-N |
| XLogP | 2.30 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|