C34H38N2O5 — CID 6614022
[(2S)-2-[2-[[(1R)-2-hydroxy-1-phenylethyl]carbamoyl]pent-4-enoylamino]-2-phenylethyl] (2R)-2-benzylpent-4-enoate (PubChem CID 6614022) has the molecular formula C34H38N2O5 and a molecular weight of 554.69 g/mol. Its IUPAC name is [(2S)-2-[2-[[(1R)-2-hydroxy-1-phenylethyl]carbamoyl]pent-4-enoylamino]-2-phenylethyl] (2R)-2-benzylpent-4-enoate.
| Compound Name | [(2S)-2-[2-[[(1R)-2-hydroxy-1-phenylethyl]carbamoyl]pent-4-enoylamino]-2-phenylethyl] (2R)-2-benzylpent-4-enoate |
|---|---|
| PubChem CID | 6614022 |
| Molecular Formula | C34H38N2O5 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | [(2S)-2-[2-[[(1R)-2-hydroxy-1-phenylethyl]carbamoyl]pent-4-enoylamino]-2-phenylethyl] (2R)-2-benzylpent-4-enoate |
| SMILES | C=CCC(C(=O)N[C@@H](CO)c1ccccc1)C(=O)N[C@H](COC(=O)[C@H](CC=C)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H38N2O5/c1-3-14-28(22-25-16-8-5-9-17-25)34(40)41-24-31(27-20-12-7-13-21-27)36-33(39)29(15-4-2)32(38)35-30(23-37)26-18-10-6-11-19-26/h3-13,16-21,28-31,37H,1-2,14-15,22-24H2,(H,35,38)(H,36,39)/t28-,29?,30+,31-/m1/s1 |
| InChIKey | CNTDNCNDEDBYQD-NSRGUSSOSA-N |
| XLogP | 4.86 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|