C35H40N2O5 — CID 6614021
[(2S)-2-[2-[[(1R)-2-hydroxy-1-phenylethyl]carbamoyl]pent-4-enoylamino]-3-phenylpropyl] (2R)-2-benzylpent-4-enoate (PubChem CID 6614021) has the molecular formula C35H40N2O5 and a molecular weight of 568.71 g/mol. Its IUPAC name is [(2S)-2-[2-[[(1R)-2-hydroxy-1-phenylethyl]carbamoyl]pent-4-enoylamino]-3-phenylpropyl] (2R)-2-benzylpent-4-enoate.
| Compound Name | [(2S)-2-[2-[[(1R)-2-hydroxy-1-phenylethyl]carbamoyl]pent-4-enoylamino]-3-phenylpropyl] (2R)-2-benzylpent-4-enoate |
|---|---|
| PubChem CID | 6614021 |
| Molecular Formula | C35H40N2O5 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | [(2S)-2-[2-[[(1R)-2-hydroxy-1-phenylethyl]carbamoyl]pent-4-enoylamino]-3-phenylpropyl] (2R)-2-benzylpent-4-enoate |
| SMILES | C=CCC(C(=O)N[C@H](COC(=O)[C@H](CC=C)Cc1ccccc1)Cc1ccccc1)C(=O)N[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C35H40N2O5/c1-3-14-29(22-26-16-8-5-9-17-26)35(41)42-25-30(23-27-18-10-6-11-19-27)36-33(39)31(15-4-2)34(40)37-32(24-38)28-20-12-7-13-21-28/h3-13,16-21,29-32,38H,1-2,14-15,22-25H2,(H,36,39)(H,37,40)/t29-,30+,31?,32+/m1/s1 |
| InChIKey | QDTRQFKYJJJEDP-VWEBZXMGSA-N |
| XLogP | 4.73 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|