C9H16N2OS — CID 66145715
4-(hydroxymethyl)-3-pentan-2-yl-1H-imidazole-2-thione (PubChem CID 66145715) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3-pentan-2-yl-1H-imidazole-2-thione.
| Compound Name | 4-(hydroxymethyl)-3-pentan-2-yl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 66145715 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4-(hydroxymethyl)-3-pentan-2-yl-1H-imidazole-2-thione |
| SMILES | CCCC(C)n1c(CO)c[nH]c1=S |
| InChI | InChI=1S/C9H16N2OS/c1-3-4-7(2)11-8(6-12)5-10-9(11)13/h5,7,12H,3-4,6H2,1-2H3,(H,10,13) |
| InChIKey | ODTYQDNGUSTKGE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|