C12H22N2O3 — CID 66190937
3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylpropan-1-amine (PubChem CID 66190937) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 66190937 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 3-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylpropan-1-amine |
| SMILES | COCc1cc(COCCCNC(C)C)no1 |
| InChI | InChI=1S/C12H22N2O3/c1-10(2)13-5-4-6-16-8-11-7-12(9-15-3)17-14-11/h7,10,13H,4-6,8-9H2,1-3H3 |
| InChIKey | MPRLGWRFABTBLF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|