C10H14N4O — CID 66195566
7-N-pyrimidin-2-yl-2-oxabicyclo[3.2.0]heptane-6,7-diamine (PubChem CID 66195566) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 7-N-pyrimidin-2-yl-2-oxabicyclo[3.2.0]heptane-6,7-diamine.
| Compound Name | 7-N-pyrimidin-2-yl-2-oxabicyclo[3.2.0]heptane-6,7-diamine |
|---|---|
| PubChem CID | 66195566 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 7-N-pyrimidin-2-yl-2-oxabicyclo[3.2.0]heptane-6,7-diamine |
| SMILES | NC1C2CCOC2C1Nc1ncccn1 |
| InChI | InChI=1S/C10H14N4O/c11-7-6-2-5-15-9(6)8(7)14-10-12-3-1-4-13-10/h1,3-4,6-9H,2,5,11H2,(H,12,13,14) |
| InChIKey | BRCQWIJNBZLNDH-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |