C13H24N2O — CID 82933048
7-N-cycloheptyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine (PubChem CID 82933048) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 7-N-cycloheptyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine.
| Compound Name | 7-N-cycloheptyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine |
|---|---|
| PubChem CID | 82933048 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 7-N-cycloheptyl-2-oxabicyclo[3.2.0]heptane-6,7-diamine |
| SMILES | NC1C2CCOC2C1NC1CCCCCC1 |
| InChI | InChI=1S/C13H24N2O/c14-11-10-7-8-16-13(10)12(11)15-9-5-3-1-2-4-6-9/h9-13,15H,1-8,14H2 |
| InChIKey | NGFWGTLICUNPNY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |