C12H17N3O — CID 66211752
8-N-pyridin-4-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine (PubChem CID 66211752) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 8-N-pyridin-4-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine.
| Compound Name | 8-N-pyridin-4-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine |
|---|---|
| PubChem CID | 66211752 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 8-N-pyridin-4-yl-2-oxabicyclo[4.2.0]octane-7,8-diamine |
| SMILES | NC1C2CCCOC2C1Nc1ccncc1 |
| InChI | InChI=1S/C12H17N3O/c13-10-9-2-1-7-16-12(9)11(10)15-8-3-5-14-6-4-8/h3-6,9-12H,1-2,7,13H2,(H,14,15) |
| InChIKey | UZAKTJYZAWONQM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |