C14H20F3NO2 — CID 66205999
2-(3,4-dimethoxyphenyl)-1,1,1-trifluoro-N-propylpropan-2-amine (PubChem CID 66205999) has the molecular formula C14H20F3NO2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,1,1-trifluoro-N-propylpropan-2-amine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1,1,1-trifluoro-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 66205999 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1,1,1-trifluoro-N-propylpropan-2-amine |
| SMILES | CCCNC(C)(c1ccc(OC)c(OC)c1)C(F)(F)F |
| InChI | InChI=1S/C14H20F3NO2/c1-5-8-18-13(2,14(15,16)17)10-6-7-11(19-3)12(9-10)20-4/h6-7,9,18H,5,8H2,1-4H3 |
| InChIKey | WSHSBIHSIISMIA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |